C11H22N4O — CID 81419957
2-ethyl-2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]butan-1-ol (PubChem CID 81419957) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-ethyl-2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 81419957 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2-ethyl-2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H22N4O/c1-3-11(4-2,8-16)7-12-6-5-10-13-9-14-15-10/h9,12,16H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | SMXBWAAFKYIREI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|