C11H16N2O4 — CID 81420269
2-amino-N-(2,3-dihydroxypropyl)-6-methoxybenzamide (PubChem CID 81420269) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-amino-N-(2,3-dihydroxypropyl)-6-methoxybenzamide.
| Compound Name | 2-amino-N-(2,3-dihydroxypropyl)-6-methoxybenzamide |
|---|---|
| PubChem CID | 81420269 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-amino-N-(2,3-dihydroxypropyl)-6-methoxybenzamide |
| SMILES | COc1cccc(N)c1C(=O)NCC(O)CO |
| InChI | InChI=1S/C11H16N2O4/c1-17-9-4-2-3-8(12)10(9)11(16)13-5-7(15)6-14/h2-4,7,14-15H,5-6,12H2,1H3,(H,13,16) |
| InChIKey | SOQLOBVWAOMVEN-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|