C14H20N2O3 — CID 81420429
(2-amino-6-methoxyphenyl)-(3-ethylmorpholin-4-yl)methanone (PubChem CID 81420429) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2-amino-6-methoxyphenyl)-(3-ethylmorpholin-4-yl)methanone.
| Compound Name | (2-amino-6-methoxyphenyl)-(3-ethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 81420429 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2-amino-6-methoxyphenyl)-(3-ethylmorpholin-4-yl)methanone |
| SMILES | CCC1COCCN1C(=O)c1c(N)cccc1OC |
| InChI | InChI=1S/C14H20N2O3/c1-3-10-9-19-8-7-16(10)14(17)13-11(15)5-4-6-12(13)18-2/h4-6,10H,3,7-9,15H2,1-2H3 |
| InChIKey | GJVAUXFQCTYSII-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|