C13H18N2O2S — CID 81420652
(2-amino-6-methoxyphenyl)-(1,4-thiazepan-4-yl)methanone (PubChem CID 81420652) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is (2-amino-6-methoxyphenyl)-(1,4-thiazepan-4-yl)methanone.
| Compound Name | (2-amino-6-methoxyphenyl)-(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 81420652 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (2-amino-6-methoxyphenyl)-(1,4-thiazepan-4-yl)methanone |
| SMILES | COc1cccc(N)c1C(=O)N1CCCSCC1 |
| InChI | InChI=1S/C13H18N2O2S/c1-17-11-5-2-4-10(14)12(11)13(16)15-6-3-8-18-9-7-15/h2,4-5H,3,6-9,14H2,1H3 |
| InChIKey | CDLWCSQVCRBRIB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|