About 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide
2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide (PubChem CID 81420849) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide.
Molecular Properties
| Compound Name | 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide |
| PubChem CID | 81420849 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide |
| SMILES | CCOc1cccc(N)c1C(=O)NCC1COCCO1 |
| InChI | InChI=1S/C14H20N2O4/c1-2-19-12-5-3-4-11(15)13(12)14(17)16-8-10-9-18-6-7-20-10/h3-5,10H,2,6-9,15H2,1H3,(H,16,17) |
| InChIKey | YSZGOCRGSXFELV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide?
The IUPAC name of 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide (CID 81420849) is 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide.
What is the SMILES notation for 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide?
The canonical SMILES for 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide is CCOc1cccc(N)c1C(=O)NCC1COCCO1.
What is the InChIKey of 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide?
The InChIKey is YSZGOCRGSXFELV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-2-19-12-5-3-4-11(15)13(12)14(17)16-8-10-9-18-6-7-20-10/h3-5,10H,2,6-9,15H2,1H3,(H,16,17).
What are the key properties of 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide?
2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide has a molecular weight of 280.32 g/mol, XLogP of 0.81, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(1,4-dioxan-2-ylmethyl)-6-ethoxybenzamide is sourced from PubChem (CID 81420849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).