C8H8F3N3O4 — CID 81421362
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 81421362) has the molecular formula C8H8F3N3O4 and a molecular weight of 267.16 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 81421362 |
| Molecular Formula | C8H8F3N3O4 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)NOCC(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O4/c9-8(10,11)4-18-13-6(16)3-14-7(17)2-1-5(15)12-14/h1-2H,3-4H2,(H,12,15)(H,13,16) |
| InChIKey | XVTKVMPHKZTYDU-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|