About [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine
[6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine (PubChem CID 81421458) has the molecular formula C14H13N3O3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine |
| PubChem CID | 81421458 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine |
| SMILES | CS(=O)(=O)c1ccc2oc(-c3ccc(CN)cn3)nc2c1 |
| InChI | InChI=1S/C14H13N3O3S/c1-21(18,19)10-3-5-13-12(6-10)17-14(20-13)11-4-2-9(7-15)8-16-11/h2-6,8H,7,15H2,1H3 |
| InChIKey | YQBKIEHOHKLJFL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine?
The IUPAC name of [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine (CID 81421458) is [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine.
What is the SMILES notation for [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine?
The canonical SMILES for [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine is CS(=O)(=O)c1ccc2oc(-c3ccc(CN)cn3)nc2c1.
What is the InChIKey of [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine?
The InChIKey is YQBKIEHOHKLJFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3S/c1-21(18,19)10-3-5-13-12(6-10)17-14(20-13)11-4-2-9(7-15)8-16-11/h2-6,8H,7,15H2,1H3.
What are the key properties of [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine?
[6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine has a molecular weight of 303.34 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-3-pyridinyl]methanamine is sourced from PubChem (CID 81421458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).