C12H9Br2ClN2O2S — CID 81421854
4-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-chlorobenzenesulfonamide (PubChem CID 81421854) has the molecular formula C12H9Br2ClN2O2S and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-chlorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 81421854 |
| Molecular Formula | C12H9Br2ClN2O2S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 437.84 |
| IUPAC Name | 4-bromo-N-(5-bromo-3-methyl-2-pyridinyl)-2-chlorobenzenesulfonamide |
| SMILES | Cc1cc(Br)cnc1NS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H9Br2ClN2O2S/c1-7-4-9(14)6-16-12(7)17-20(18,19)11-3-2-8(13)5-10(11)15/h2-6H,1H3,(H,16,17) |
| InChIKey | FXQVAVZBBDNMAR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |