C19H23N — CID 81422447
N,2,2-trimethyl-3,4-diphenylcyclobutan-1-amine (PubChem CID 81422447) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is N,2,2-trimethyl-3,4-diphenylcyclobutan-1-amine.
| Compound Name | N,2,2-trimethyl-3,4-diphenylcyclobutan-1-amine |
|---|---|
| PubChem CID | 81422447 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N,2,2-trimethyl-3,4-diphenylcyclobutan-1-amine |
| SMILES | CNC1C(c2ccccc2)C(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C19H23N/c1-19(2)17(15-12-8-5-9-13-15)16(18(19)20-3)14-10-6-4-7-11-14/h4-13,16-18,20H,1-3H3 |
| InChIKey | LIEJEGSRDNDERK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |