C11H22FN — CID 81422951
N-(3-fluoropropyl)-3,3-dimethylcyclohexan-1-amine (PubChem CID 81422951) has the molecular formula C11H22FN and a molecular weight of 187.30 g/mol. Its IUPAC name is N-(3-fluoropropyl)-3,3-dimethylcyclohexan-1-amine.
| Compound Name | N-(3-fluoropropyl)-3,3-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 81422951 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | N-(3-fluoropropyl)-3,3-dimethylcyclohexan-1-amine |
| SMILES | CC1(C)CCCC(NCCCF)C1 |
| InChI | InChI=1S/C11H22FN/c1-11(2)6-3-5-10(9-11)13-8-4-7-12/h10,13H,3-9H2,1-2H3 |
| InChIKey | XANXTLIHYZBCJG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|