C12H25NO2S — CID 81422987
N-(2-ethylsulfonylethyl)-3,3-dimethylcyclohexan-1-amine (PubChem CID 81422987) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)-3,3-dimethylcyclohexan-1-amine.
| Compound Name | N-(2-ethylsulfonylethyl)-3,3-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 81422987 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-(2-ethylsulfonylethyl)-3,3-dimethylcyclohexan-1-amine |
| SMILES | CCS(=O)(=O)CCNC1CCCC(C)(C)C1 |
| InChI | InChI=1S/C12H25NO2S/c1-4-16(14,15)9-8-13-11-6-5-7-12(2,3)10-11/h11,13H,4-10H2,1-3H3 |
| InChIKey | XIEYAXDHSKGJBS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |