C10H14N2O4S — CID 81423499
3,5-dimethyl-4-(prop-2-enylsulfamoyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 81423499) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3,5-dimethyl-4-(prop-2-enylsulfamoyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3,5-dimethyl-4-(prop-2-enylsulfamoyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 81423499 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3,5-dimethyl-4-(prop-2-enylsulfamoyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | C=CCNS(=O)(=O)c1c(C)[nH]c(C(=O)O)c1C |
| InChI | InChI=1S/C10H14N2O4S/c1-4-5-11-17(15,16)9-6(2)8(10(13)14)12-7(9)3/h4,11-12H,1,5H2,2-3H3,(H,13,14) |
| InChIKey | SIVFBHAFUUWSJY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|