C16H27N3OS — CID 81424448
2-methoxy-N-[[2-(propylsulfanylmethyl)-5,6,7,8-tetrahydroquinazolin-6-yl]methyl]ethanamine (PubChem CID 81424448) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-methoxy-N-[[2-(propylsulfanylmethyl)-5,6,7,8-tetrahydroquinazolin-6-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[2-(propylsulfanylmethyl)-5,6,7,8-tetrahydroquinazolin-6-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 81424448 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-methoxy-N-[[2-(propylsulfanylmethyl)-5,6,7,8-tetrahydroquinazolin-6-yl]methyl]ethanamine |
| SMILES | CCCSCc1ncc2c(n1)CCC(CNCCOC)C2 |
| InChI | InChI=1S/C16H27N3OS/c1-3-8-21-12-16-18-11-14-9-13(4-5-15(14)19-16)10-17-6-7-20-2/h11,13,17H,3-10,12H2,1-2H3 |
| InChIKey | AHWFJJIXEVTEOJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|