C14H12ClN5O — CID 81427697
4-chloro-6-methoxy-N-(quinolin-8-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 81427697) has the molecular formula C14H12ClN5O and a molecular weight of 301.74 g/mol. Its IUPAC name is 4-chloro-6-methoxy-N-(quinolin-8-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-methoxy-N-(quinolin-8-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 81427697 |
| Molecular Formula | C14H12ClN5O |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-chloro-6-methoxy-N-(quinolin-8-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Cl)nc(NCc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C14H12ClN5O/c1-21-14-19-12(15)18-13(20-14)17-8-10-5-2-4-9-6-3-7-16-11(9)10/h2-7H,8H2,1H3,(H,17,18,19,20) |
| InChIKey | YFYXVKVVBFYBPA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |