4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid

C15H11NO4S — CID 81428465

IUPAC4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid
SMILESCOc1ccc(C(=O)O)cc1-n1sc2ccccc2c1=O
InChIInChI=1S/C15H11NO4S/c1-20-12-7-6-9(15(18)19)8-11(12)16-14(17)10-4-2-3-5-13(10)21-16/h2-8H,1H3,(H,18,19)
InChIKeyZXTTUZPSDYAJBD-UHFFFAOYSA-N
MW301.32 g/mol
LogP2.76
Rot. Bonds3

About 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid

4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid (PubChem CID 81428465) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid.

Molecular Properties

Compound Name4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid
PubChem CID81428465
Molecular FormulaC15H11NO4S
Molecular Weight301.32 g/mol
Exact Mass301.04
IUPAC Name4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid
SMILESCOc1ccc(C(=O)O)cc1-n1sc2ccccc2c1=O
InChIInChI=1S/C15H11NO4S/c1-20-12-7-6-9(15(18)19)8-11(12)16-14(17)10-4-2-3-5-13(10)21-16/h2-8H,1H3,(H,18,19)
InChIKeyZXTTUZPSDYAJBD-UHFFFAOYSA-N
XLogP2.76
TPSA68.53 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.32
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid?
The IUPAC name of 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid (CID 81428465) is 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid.
What is the SMILES notation for 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid?
The canonical SMILES for 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid is COc1ccc(C(=O)O)cc1-n1sc2ccccc2c1=O.
What is the InChIKey of 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid?
The InChIKey is ZXTTUZPSDYAJBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO4S/c1-20-12-7-6-9(15(18)19)8-11(12)16-14(17)10-4-2-3-5-13(10)21-16/h2-8H,1H3,(H,18,19).
What are the key properties of 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid?
4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid has a molecular weight of 301.32 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid is sourced from PubChem (CID 81428465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).