C13H17ClN2O — CID 81428539
2-(4-chlorophenyl)-1-[(3R)-3-methylpiperazin-1-yl]ethanone (PubChem CID 81428539) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[(3R)-3-methylpiperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[(3R)-3-methylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 81428539 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[(3R)-3-methylpiperazin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)Cc2ccc(Cl)cc2)CCN1 |
| InChI | InChI=1S/C13H17ClN2O/c1-10-9-16(7-6-15-10)13(17)8-11-2-4-12(14)5-3-11/h2-5,10,15H,6-9H2,1H3/t10-/m1/s1 |
| InChIKey | VTTPEZQPSQRZBW-SNVBAGLBSA-N |
| XLogP | 1.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |