About 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran
3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran (PubChem CID 81429043) has the molecular formula C19H19ClO
and a molecular weight of 298.81 g/mol. Its IUPAC name is 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran.
Molecular Properties
| Compound Name | 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran |
| PubChem CID | 81429043 |
| Molecular Formula | C19H19ClO |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran |
| SMILES | Cc1ccc2ccccc2c1C(Cl)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C19H19ClO/c1-11-9-10-15-7-5-6-8-16(15)17(11)19(20)18-12(2)13(3)21-14(18)4/h5-10,19H,1-4H3 |
| InChIKey | UIBSZXYORDLHBS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran?
The IUPAC name of 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran (CID 81429043) is 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran.
What is the SMILES notation for 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran?
The canonical SMILES for 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran is Cc1ccc2ccccc2c1C(Cl)c1c(C)oc(C)c1C.
What is the InChIKey of 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran?
The InChIKey is UIBSZXYORDLHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClO/c1-11-9-10-15-7-5-6-8-16(15)17(11)19(20)18-12(2)13(3)21-14(18)4/h5-10,19H,1-4H3.
What are the key properties of 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran?
3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran has a molecular weight of 298.81 g/mol, XLogP of 5.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro-(2-methylnaphthalen-1-yl)methyl]-2,4,5-trimethylfuran is sourced from PubChem (CID 81429043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).