About (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine
(E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine (PubChem CID 81429533) has the molecular formula C9H16ClNO2S
and a molecular weight of 237.75 g/mol. Its IUPAC name is (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine |
| PubChem CID | 81429533 |
| Molecular Formula | C9H16ClNO2S |
| Molecular Weight | 237.75 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine |
| SMILES | O=S1(=O)CCC(CNC/C=C/CCl)C1 |
| InChI | InChI=1S/C9H16ClNO2S/c10-4-1-2-5-11-7-9-3-6-14(12,13)8-9/h1-2,9,11H,3-8H2/b2-1+ |
| InChIKey | HUVONYHXZVUECH-OWOJBTEDSA-N |
| XLogP | 0.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.75 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine?
The IUPAC name of (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine (CID 81429533) is (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine.
What is the SMILES notation for (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine?
The canonical SMILES for (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine is O=S1(=O)CCC(CNC/C=C/CCl)C1.
What is the InChIKey of (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine?
The InChIKey is HUVONYHXZVUECH-OWOJBTEDSA-N. The full InChI is InChI=1S/C9H16ClNO2S/c10-4-1-2-5-11-7-9-3-6-14(12,13)8-9/h1-2,9,11H,3-8H2/b2-1+.
What are the key properties of (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine?
(E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine has a molecular weight of 237.75 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]but-2-en-1-amine is sourced from PubChem (CID 81429533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).