About 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea
3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea (PubChem CID 81429632) has the molecular formula C9H17ClN2O
and a molecular weight of 204.70 g/mol. Its IUPAC name is 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea |
| PubChem CID | 81429632 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC/C=C/CCl |
| InChI | InChI=1S/C9H17ClN2O/c1-3-12(4-2)9(13)11-8-6-5-7-10/h5-6H,3-4,7-8H2,1-2H3,(H,11,13)/b6-5+ |
| InChIKey | WZXBAZOLOVWYJY-AATRIKPKSA-N |
| XLogP | 1.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea?
The IUPAC name of 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea (CID 81429632) is 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea.
What is the SMILES notation for 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea?
The canonical SMILES for 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea is CCN(CC)C(=O)NC/C=C/CCl.
What is the InChIKey of 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea?
The InChIKey is WZXBAZOLOVWYJY-AATRIKPKSA-N. The full InChI is InChI=1S/C9H17ClN2O/c1-3-12(4-2)9(13)11-8-6-5-7-10/h5-6H,3-4,7-8H2,1-2H3,(H,11,13)/b6-5+.
What are the key properties of 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea?
3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea has a molecular weight of 204.70 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-4-chlorobut-2-enyl]-1,1-diethylurea is sourced from PubChem (CID 81429632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).