C10H10ClN3O2S2 — CID 81429633
N-[(E)-4-chlorobut-2-enyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaene-2-sulfonamide (PubChem CID 81429633) has the molecular formula C10H10ClN3O2S2 and a molecular weight of 303.80 g/mol. Its IUPAC name is N-[(E)-4-chlorobut-2-enyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaene-2-sulfonamide.
| Compound Name | N-[(E)-4-chlorobut-2-enyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaene-2-sulfonamide |
|---|---|
| PubChem CID | 81429633 |
| Molecular Formula | C10H10ClN3O2S2 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | N-[(E)-4-chlorobut-2-enyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaene-2-sulfonamide |
| SMILES | O=S(=O)(NC/C=C/CCl)c1cccc2c1N=S=N2 |
| InChI | InChI=1S/C10H10ClN3O2S2/c11-6-1-2-7-12-18(15,16)9-5-3-4-8-10(9)14-17-13-8/h1-5,12H,6-7H2/b2-1+ |
| InChIKey | NVCKLLAWZZIKLJ-OWOJBTEDSA-N |
| XLogP | 2.49 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|