C18H15Cl2N — CID 81430120
(3,5-dichlorophenyl)-(2-methylnaphthalen-1-yl)methanamine (PubChem CID 81430120) has the molecular formula C18H15Cl2N and a molecular weight of 316.23 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-(2-methylnaphthalen-1-yl)methanamine.
| Compound Name | (3,5-dichlorophenyl)-(2-methylnaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 81430120 |
| Molecular Formula | C18H15Cl2N |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (3,5-dichlorophenyl)-(2-methylnaphthalen-1-yl)methanamine |
| SMILES | Cc1ccc2ccccc2c1C(N)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N/c1-11-6-7-12-4-2-3-5-16(12)17(11)18(21)13-8-14(19)10-15(20)9-13/h2-10,18H,21H2,1H3 |
| InChIKey | WXQYDQZBOKEAKJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |