C17H20BrFN2 — CID 81432197
1-(4-bromo-3-fluorophenyl)-N-ethyl-N-(4-methylphenyl)ethane-1,2-diamine (PubChem CID 81432197) has the molecular formula C17H20BrFN2 and a molecular weight of 351.26 g/mol. Its IUPAC name is 1-(4-bromo-3-fluorophenyl)-N-ethyl-N-(4-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(4-bromo-3-fluorophenyl)-N-ethyl-N-(4-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 81432197 |
| Molecular Formula | C17H20BrFN2 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 1-(4-bromo-3-fluorophenyl)-N-ethyl-N-(4-methylphenyl)ethane-1,2-diamine |
| SMILES | CCN(c1ccc(C)cc1)C(CN)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C17H20BrFN2/c1-3-21(14-7-4-12(2)5-8-14)17(11-20)13-6-9-15(18)16(19)10-13/h4-10,17H,3,11,20H2,1-2H3 |
| InChIKey | UBIIDKXEJLXELC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|