About 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine
3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine (PubChem CID 81433092) has the molecular formula C12H14N2O4S
and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine.
Molecular Properties
| Compound Name | 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine |
| PubChem CID | 81433092 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine |
| SMILES | CS(=O)(=O)c1ccc2oc(C3(N)CCOC3)nc2c1 |
| InChI | InChI=1S/C12H14N2O4S/c1-19(15,16)8-2-3-10-9(6-8)14-11(18-10)12(13)4-5-17-7-12/h2-3,6H,4-5,7,13H2,1H3 |
| InChIKey | PZOTXGIFQHOYBD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine?
The IUPAC name of 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine (CID 81433092) is 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine.
What is the SMILES notation for 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine?
The canonical SMILES for 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine is CS(=O)(=O)c1ccc2oc(C3(N)CCOC3)nc2c1.
What is the InChIKey of 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine?
The InChIKey is PZOTXGIFQHOYBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4S/c1-19(15,16)8-2-3-10-9(6-8)14-11(18-10)12(13)4-5-17-7-12/h2-3,6H,4-5,7,13H2,1H3.
What are the key properties of 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine?
3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine has a molecular weight of 282.32 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methylsulfonyl-1,3-benzoxazol-2-yl)oxolan-3-amine is sourced from PubChem (CID 81433092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).