About 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine
6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 81433623) has the molecular formula C14H15NO3S2
and a molecular weight of 309.41 g/mol. Its IUPAC name is 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 81433623 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1ccc(C2CNc3cc(S(C)(=O)=O)ccc3O2)s1 |
| InChI | InChI=1S/C14H15NO3S2/c1-9-3-6-14(19-9)13-8-15-11-7-10(20(2,16)17)4-5-12(11)18-13/h3-7,13,15H,8H2,1-2H3 |
| InChIKey | BZIQNCLGBBSZLR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine (CID 81433623) is 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine is Cc1ccc(C2CNc3cc(S(C)(=O)=O)ccc3O2)s1.
What is the InChIKey of 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is BZIQNCLGBBSZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3S2/c1-9-3-6-14(19-9)13-8-15-11-7-10(20(2,16)17)4-5-12(11)18-13/h3-7,13,15H,8H2,1-2H3.
What are the key properties of 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine?
6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 309.41 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfonyl-2-(5-methylthiophen-2-yl)-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 81433623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).