About N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide
N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 81434239) has the molecular formula C6H10F2N2OS
and a molecular weight of 196.22 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide |
| PubChem CID | 81434239 |
| Molecular Formula | C6H10F2N2OS |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCC(F)F)C1CSCN1 |
| InChI | InChI=1S/C6H10F2N2OS/c7-5(8)1-9-6(11)4-2-12-3-10-4/h4-5,10H,1-3H2,(H,9,11) |
| InChIKey | OFKQQHBUQXKQMR-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide?
The IUPAC name of N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide (CID 81434239) is N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide?
The canonical SMILES for N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide is O=C(NCC(F)F)C1CSCN1.
What is the InChIKey of N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide?
The InChIKey is OFKQQHBUQXKQMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N2OS/c7-5(8)1-9-6(11)4-2-12-3-10-4/h4-5,10H,1-3H2,(H,9,11).
What are the key properties of N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide?
N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide has a molecular weight of 196.22 g/mol, XLogP of 0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-1,3-thiazolidine-4-carboxamide is sourced from PubChem (CID 81434239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).