About 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine
5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine (PubChem CID 81434358) has the molecular formula C11H10N4O3S
and a molecular weight of 278.29 g/mol. Its IUPAC name is 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine |
| PubChem CID | 81434358 |
| Molecular Formula | C11H10N4O3S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine |
| SMILES | CS(=O)(=O)c1ccc2oc(-c3cc(N)n[nH]3)nc2c1 |
| InChI | InChI=1S/C11H10N4O3S/c1-19(16,17)6-2-3-9-7(4-6)13-11(18-9)8-5-10(12)15-14-8/h2-5H,1H3,(H3,12,14,15) |
| InChIKey | PJMCBWOOPHYSSM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine?
The IUPAC name of 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine (CID 81434358) is 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine?
The canonical SMILES for 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine is CS(=O)(=O)c1ccc2oc(-c3cc(N)n[nH]3)nc2c1.
What is the InChIKey of 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine?
The InChIKey is PJMCBWOOPHYSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O3S/c1-19(16,17)6-2-3-9-7(4-6)13-11(18-9)8-5-10(12)15-14-8/h2-5H,1H3,(H3,12,14,15).
What are the key properties of 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine?
5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine has a molecular weight of 278.29 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methylsulfonyl-1,3-benzoxazol-2-yl)-1H-pyrazol-3-amine is sourced from PubChem (CID 81434358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).