About 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide
4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide (PubChem CID 81434392) has the molecular formula C14H10N2OS2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide.
Molecular Properties
| Compound Name | 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide |
| PubChem CID | 81434392 |
| Molecular Formula | C14H10N2OS2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(-n2sc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C14H10N2OS2/c15-13(18)9-5-7-10(8-6-9)16-14(17)11-3-1-2-4-12(11)19-16/h1-8H,(H2,15,18) |
| InChIKey | JAPGLWLKZYXLOU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide?
The IUPAC name of 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide (CID 81434392) is 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide.
What is the SMILES notation for 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide?
The canonical SMILES for 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide is NC(=S)c1ccc(-n2sc3ccccc3c2=O)cc1.
What is the InChIKey of 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide?
The InChIKey is JAPGLWLKZYXLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2OS2/c15-13(18)9-5-7-10(8-6-9)16-14(17)11-3-1-2-4-12(11)19-16/h1-8H,(H2,15,18).
What are the key properties of 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide?
4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide has a molecular weight of 286.38 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-oxo-1,2-benzothiazol-2-yl)benzenecarbothioamide is sourced from PubChem (CID 81434392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).