C16H17N5 — CID 81435677
6-N,5-dimethyl-4-N-(quinolin-8-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 81435677) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 6-N,5-dimethyl-4-N-(quinolin-8-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N,5-dimethyl-4-N-(quinolin-8-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 81435677 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 6-N,5-dimethyl-4-N-(quinolin-8-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(NCc2cccc3cccnc23)c1C |
| InChI | InChI=1S/C16H17N5/c1-11-15(17-2)20-10-21-16(11)19-9-13-6-3-5-12-7-4-8-18-14(12)13/h3-8,10H,9H2,1-2H3,(H2,17,19,20,21) |
| InChIKey | YPMAEPSBKQVRQG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |