C15H15BrFN — CID 81436699
N-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylaniline (PubChem CID 81436699) has the molecular formula C15H15BrFN and a molecular weight of 308.19 g/mol. Its IUPAC name is N-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylaniline.
| Compound Name | N-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylaniline |
|---|---|
| PubChem CID | 81436699 |
| Molecular Formula | C15H15BrFN |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(NCc2ccc(Br)c(F)c2)c1 |
| InChI | InChI=1S/C15H15BrFN/c1-10-5-11(2)7-13(6-10)18-9-12-3-4-14(16)15(17)8-12/h3-8,18H,9H2,1-2H3 |
| InChIKey | CBRYSJOQEZEAFI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |