C14H13N3O4 — CID 81439191
5-amino-2-[(3-hydroxypyridine-4-carbonyl)-methylamino]benzoic acid (PubChem CID 81439191) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 5-amino-2-[(3-hydroxypyridine-4-carbonyl)-methylamino]benzoic acid.
| Compound Name | 5-amino-2-[(3-hydroxypyridine-4-carbonyl)-methylamino]benzoic acid |
|---|---|
| PubChem CID | 81439191 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-amino-2-[(3-hydroxypyridine-4-carbonyl)-methylamino]benzoic acid |
| SMILES | CN(C(=O)c1ccncc1O)c1ccc(N)cc1C(=O)O |
| InChI | InChI=1S/C14H13N3O4/c1-17(13(19)9-4-5-16-7-12(9)18)11-3-2-8(15)6-10(11)14(20)21/h2-7,18H,15H2,1H3,(H,20,21) |
| InChIKey | OJEAJKCRCIOMKU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|