5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid

C13H19N3O2 — CID 81439379

IUPAC5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid
SMILESCC1CCCC(C)N1c1ncc(C(=O)O)cc1N
InChIInChI=1S/C13H19N3O2/c1-8-4-3-5-9(2)16(8)12-11(14)6-10(7-15-12)13(17)18/h6-9H,3-5,14H2,1-2H3,(H,17,18)
InChIKeyUCLDRPPTKSZZIP-UHFFFAOYSA-N
MW249.31 g/mol
LogP2.13
Rot. Bonds2

About 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid

5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid (PubChem CID 81439379) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid
PubChem CID81439379
Molecular FormulaC13H19N3O2
Molecular Weight249.31 g/mol
Exact Mass249.15
IUPAC Name5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid
SMILESCC1CCCC(C)N1c1ncc(C(=O)O)cc1N
InChIInChI=1S/C13H19N3O2/c1-8-4-3-5-9(2)16(8)12-11(14)6-10(7-15-12)13(17)18/h6-9H,3-5,14H2,1-2H3,(H,17,18)
InChIKeyUCLDRPPTKSZZIP-UHFFFAOYSA-N
XLogP2.13
TPSA79.45 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid?
The IUPAC name of 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid (CID 81439379) is 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid is CC1CCCC(C)N1c1ncc(C(=O)O)cc1N.
What is the InChIKey of 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid?
The InChIKey is UCLDRPPTKSZZIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-8-4-3-5-9(2)16(8)12-11(14)6-10(7-15-12)13(17)18/h6-9H,3-5,14H2,1-2H3,(H,17,18).
What are the key properties of 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid?
5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid has a molecular weight of 249.31 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(2,6-dimethylpiperidin-1-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 81439379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).