About 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid
5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid (PubChem CID 81439996) has the molecular formula C9H6N6O2
and a molecular weight of 230.19 g/mol. Its IUPAC name is 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid |
| PubChem CID | 81439996 |
| Molecular Formula | C9H6N6O2 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid |
| SMILES | N#Cc1ncn(-c2ncc(C(=O)O)cc2N)n1 |
| InChI | InChI=1S/C9H6N6O2/c10-2-7-13-4-15(14-7)8-6(11)1-5(3-12-8)9(16)17/h1,3-4H,11H2,(H,16,17) |
| InChIKey | RXGPPWUKYIZDAJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid?
The IUPAC name of 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid (CID 81439996) is 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid is N#Cc1ncn(-c2ncc(C(=O)O)cc2N)n1.
What is the InChIKey of 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid?
The InChIKey is RXGPPWUKYIZDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N6O2/c10-2-7-13-4-15(14-7)8-6(11)1-5(3-12-8)9(16)17/h1,3-4H,11H2,(H,16,17).
What are the key properties of 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid?
5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid has a molecular weight of 230.19 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(3-cyano-1,2,4-triazol-1-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 81439996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).