C11H4ClF3N4 — CID 81440573
5-chloro-3-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 81440573) has the molecular formula C11H4ClF3N4 and a molecular weight of 284.63 g/mol. Its IUPAC name is 5-chloro-3-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 5-chloro-3-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 81440573 |
| Molecular Formula | C11H4ClF3N4 |
| Molecular Weight | 284.63 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 5-chloro-3-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Fc1cc(-c2nnc3cncc(Cl)n23)cc(F)c1F |
| InChI | InChI=1S/C11H4ClF3N4/c12-8-3-16-4-9-17-18-11(19(8)9)5-1-6(13)10(15)7(14)2-5/h1-4H |
| InChIKey | HEUIESQSEZMJNQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.63 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|