About [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol
[1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol (PubChem CID 81440704) has the molecular formula C16H23BrFNO
and a molecular weight of 344.27 g/mol. Its IUPAC name is [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol.
Molecular Properties
| Compound Name | [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol |
| PubChem CID | 81440704 |
| Molecular Formula | C16H23BrFNO |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol |
| SMILES | CC1(C)CCC(CN)(C(O)c2ccc(Br)c(F)c2)CC1 |
| InChI | InChI=1S/C16H23BrFNO/c1-15(2)5-7-16(10-19,8-6-15)14(20)11-3-4-12(17)13(18)9-11/h3-4,9,14,20H,5-8,10,19H2,1-2H3 |
| InChIKey | OIHCRGJBYZVXHL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol?
The IUPAC name of [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol (CID 81440704) is [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol.
What is the SMILES notation for [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol?
The canonical SMILES for [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol is CC1(C)CCC(CN)(C(O)c2ccc(Br)c(F)c2)CC1.
What is the InChIKey of [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol?
The InChIKey is OIHCRGJBYZVXHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23BrFNO/c1-15(2)5-7-16(10-19,8-6-15)14(20)11-3-4-12(17)13(18)9-11/h3-4,9,14,20H,5-8,10,19H2,1-2H3.
What are the key properties of [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol?
[1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol has a molecular weight of 344.27 g/mol, XLogP of 4.17, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(aminomethyl)-4,4-dimethylcyclohexyl]-(4-bromo-3-fluorophenyl)methanol is sourced from PubChem (CID 81440704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).