About (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol
(5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol (PubChem CID 81441170) has the molecular formula C6H5ClN4O
and a molecular weight of 184.59 g/mol. Its IUPAC name is (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol.
Molecular Properties
| Compound Name | (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol |
| PubChem CID | 81441170 |
| Molecular Formula | C6H5ClN4O |
| Molecular Weight | 184.59 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol |
| SMILES | OCc1nnc2cncc(Cl)n12 |
| InChI | InChI=1S/C6H5ClN4O/c7-4-1-8-2-5-9-10-6(3-12)11(4)5/h1-2,12H,3H2 |
| InChIKey | CPYMDUDDIDMECB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.59 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol?
The IUPAC name of (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol (CID 81441170) is (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol.
What is the SMILES notation for (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol?
The canonical SMILES for (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol is OCc1nnc2cncc(Cl)n12.
What is the InChIKey of (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol?
The InChIKey is CPYMDUDDIDMECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN4O/c7-4-1-8-2-5-9-10-6(3-12)11(4)5/h1-2,12H,3H2.
What are the key properties of (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol?
(5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol has a molecular weight of 184.59 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methanol is sourced from PubChem (CID 81441170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).