About 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane
2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane (PubChem CID 81441856) has the molecular formula C11H13BrFNS
and a molecular weight of 290.20 g/mol. Its IUPAC name is 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane |
| PubChem CID | 81441856 |
| Molecular Formula | C11H13BrFNS |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane |
| SMILES | CC1CCSC(c2ccc(Br)c(F)c2)N1 |
| InChI | InChI=1S/C11H13BrFNS/c1-7-4-5-15-11(14-7)8-2-3-9(12)10(13)6-8/h2-3,6-7,11,14H,4-5H2,1H3 |
| InChIKey | LJPAJVDWVDBTPQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane?
The IUPAC name of 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane (CID 81441856) is 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane.
What is the SMILES notation for 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane?
The canonical SMILES for 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane is CC1CCSC(c2ccc(Br)c(F)c2)N1.
What is the InChIKey of 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane?
The InChIKey is LJPAJVDWVDBTPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrFNS/c1-7-4-5-15-11(14-7)8-2-3-9(12)10(13)6-8/h2-3,6-7,11,14H,4-5H2,1H3.
What are the key properties of 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane?
2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane has a molecular weight of 290.20 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3-fluorophenyl)-4-methyl-1,3-thiazinane is sourced from PubChem (CID 81441856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).