About 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine
5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 81442348) has the molecular formula C9H9ClN4
and a molecular weight of 208.65 g/mol. Its IUPAC name is 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine.
Molecular Properties
| Compound Name | 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine |
| PubChem CID | 81442348 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Clc1cncc2nnc(C3CCC3)n12 |
| InChI | InChI=1S/C9H9ClN4/c10-7-4-11-5-8-12-13-9(14(7)8)6-2-1-3-6/h4-6H,1-3H2 |
| InChIKey | LDABWJUJHMOALF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine?
The IUPAC name of 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine (CID 81442348) is 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine.
What is the SMILES notation for 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine?
The canonical SMILES for 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine is Clc1cncc2nnc(C3CCC3)n12.
What is the InChIKey of 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine?
The InChIKey is LDABWJUJHMOALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN4/c10-7-4-11-5-8-12-13-9(14(7)8)6-2-1-3-6/h4-6H,1-3H2.
What are the key properties of 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine?
5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine has a molecular weight of 208.65 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-a]pyrazine is sourced from PubChem (CID 81442348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).