About 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol
2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol (PubChem CID 81444157) has the molecular formula C17H15NO
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol.
Molecular Properties
| Compound Name | 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol |
| PubChem CID | 81444157 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(c2ccc3[nH]ccc3c2)Cc2ccccc2C1 |
| InChI | InChI=1S/C17H15NO/c19-17(10-13-3-1-2-4-14(13)11-17)15-5-6-16-12(9-15)7-8-18-16/h1-9,18-19H,10-11H2 |
| InChIKey | NXLIAIRNPSVOGR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol?
The IUPAC name of 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol (CID 81444157) is 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol.
What is the SMILES notation for 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol?
The canonical SMILES for 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol is OC1(c2ccc3[nH]ccc3c2)Cc2ccccc2C1.
What is the InChIKey of 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol?
The InChIKey is NXLIAIRNPSVOGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO/c19-17(10-13-3-1-2-4-14(13)11-17)15-5-6-16-12(9-15)7-8-18-16/h1-9,18-19H,10-11H2.
What are the key properties of 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol?
2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol has a molecular weight of 249.31 g/mol, XLogP of 3.15, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-5-yl)-1,3-dihydroinden-2-ol is sourced from PubChem (CID 81444157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).