C16H15NO2 — CID 81445768
N-(3-hydroxyphenyl)-2-phenylcyclopropane-1-carboxamide (PubChem CID 81445768) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 81445768 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(3-hydroxyphenyl)-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cccc(O)c1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C16H15NO2/c18-13-8-4-7-12(9-13)17-16(19)15-10-14(15)11-5-2-1-3-6-11/h1-9,14-15,18H,10H2,(H,17,19) |
| InChIKey | RYSGGSNYVZNZAK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |