C14H15ClFNS — CID 81446769
N-[[4-(5-chlorothiophen-2-yl)-3-fluorophenyl]methyl]propan-2-amine (PubChem CID 81446769) has the molecular formula C14H15ClFNS and a molecular weight of 283.80 g/mol. Its IUPAC name is N-[[4-(5-chlorothiophen-2-yl)-3-fluorophenyl]methyl]propan-2-amine.
| Compound Name | N-[[4-(5-chlorothiophen-2-yl)-3-fluorophenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 81446769 |
| Molecular Formula | C14H15ClFNS |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-[[4-(5-chlorothiophen-2-yl)-3-fluorophenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(-c2ccc(Cl)s2)c(F)c1 |
| InChI | InChI=1S/C14H15ClFNS/c1-9(2)17-8-10-3-4-11(12(16)7-10)13-5-6-14(15)18-13/h3-7,9,17H,8H2,1-2H3 |
| InChIKey | TVNWZFYLQJPSEL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |