About ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate
ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate (PubChem CID 81448307) has the molecular formula C14H14F2N2O2
and a molecular weight of 280.27 g/mol. Its IUPAC name is ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate |
| PubChem CID | 81448307 |
| Molecular Formula | C14H14F2N2O2 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2nc3c(F)cc(F)cc3[nH]2)CCC1 |
| InChI | InChI=1S/C14H14F2N2O2/c1-2-20-13(19)14(4-3-5-14)12-17-10-7-8(15)6-9(16)11(10)18-12/h6-7H,2-5H2,1H3,(H,17,18) |
| InChIKey | YEJKQLJONVIBFG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate?
The IUPAC name of ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate (CID 81448307) is ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate.
What is the SMILES notation for ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate?
The canonical SMILES for ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate is CCOC(=O)C1(c2nc3c(F)cc(F)cc3[nH]2)CCC1.
What is the InChIKey of ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate?
The InChIKey is YEJKQLJONVIBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2O2/c1-2-20-13(19)14(4-3-5-14)12-17-10-7-8(15)6-9(16)11(10)18-12/h6-7H,2-5H2,1H3,(H,17,18).
What are the key properties of ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate?
ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate has a molecular weight of 280.27 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(4,6-difluoro-1H-benzimidazol-2-yl)cyclobutane-1-carboxylate is sourced from PubChem (CID 81448307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).