About 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine
4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine (PubChem CID 81449227) has the molecular formula C13H12F2N4S
and a molecular weight of 294.33 g/mol. Its IUPAC name is 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine |
| PubChem CID | 81449227 |
| Molecular Formula | C13H12F2N4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CCCc2nc3c(F)cc(F)cc3[nH]2)cs1 |
| InChI | InChI=1S/C13H12F2N4S/c14-7-4-9(15)12-10(5-7)18-11(19-12)3-1-2-8-6-20-13(16)17-8/h4-6H,1-3H2,(H2,16,17)(H,18,19) |
| InChIKey | GGFPLFLAMHWWBD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine (CID 81449227) is 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine is Nc1nc(CCCc2nc3c(F)cc(F)cc3[nH]2)cs1.
What is the InChIKey of 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine?
The InChIKey is GGFPLFLAMHWWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N4S/c14-7-4-9(15)12-10(5-7)18-11(19-12)3-1-2-8-6-20-13(16)17-8/h4-6H,1-3H2,(H2,16,17)(H,18,19).
What are the key properties of 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine?
4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine has a molecular weight of 294.33 g/mol, XLogP of 3.06, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4,6-difluoro-1H-benzimidazol-2-yl)propyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 81449227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).