C13H14ClFN2O2S2 — CID 81450686
4-chloro-3-fluoro-5-(methylaminomethyl)-N-(thiophen-3-ylmethyl)benzenesulfonamide (PubChem CID 81450686) has the molecular formula C13H14ClFN2O2S2 and a molecular weight of 348.85 g/mol. Its IUPAC name is 4-chloro-3-fluoro-5-(methylaminomethyl)-N-(thiophen-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-3-fluoro-5-(methylaminomethyl)-N-(thiophen-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81450686 |
| Molecular Formula | C13H14ClFN2O2S2 |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 4-chloro-3-fluoro-5-(methylaminomethyl)-N-(thiophen-3-ylmethyl)benzenesulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCc2ccsc2)cc(F)c1Cl |
| InChI | InChI=1S/C13H14ClFN2O2S2/c1-16-7-10-4-11(5-12(15)13(10)14)21(18,19)17-6-9-2-3-20-8-9/h2-5,8,16-17H,6-7H2,1H3 |
| InChIKey | TWRKUFATNQNZNR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |