About [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine
[2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine (PubChem CID 81450845) has the molecular formula C14H20ClFN2O2S
and a molecular weight of 334.84 g/mol. Its IUPAC name is [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine.
Molecular Properties
| Compound Name | [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine |
| PubChem CID | 81450845 |
| Molecular Formula | C14H20ClFN2O2S |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1cc(F)c(Cl)c(CN)c1 |
| InChI | InChI=1S/C14H20ClFN2O2S/c1-9-4-3-5-10(2)18(9)21(19,20)12-6-11(8-17)14(15)13(16)7-12/h6-7,9-10H,3-5,8,17H2,1-2H3 |
| InChIKey | ZJJTWYMGWXQLMB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine?
The IUPAC name of [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine (CID 81450845) is [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine.
What is the SMILES notation for [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine?
The canonical SMILES for [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine is CC1CCCC(C)N1S(=O)(=O)c1cc(F)c(Cl)c(CN)c1.
What is the InChIKey of [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine?
The InChIKey is ZJJTWYMGWXQLMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClFN2O2S/c1-9-4-3-5-10(2)18(9)21(19,20)12-6-11(8-17)14(15)13(16)7-12/h6-7,9-10H,3-5,8,17H2,1-2H3.
What are the key properties of [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine?
[2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine has a molecular weight of 334.84 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-3-fluorophenyl]methanamine is sourced from PubChem (CID 81450845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).