About 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one
3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 814514) has the molecular formula C12H12N4O
and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one.
Molecular Properties
| Compound Name | 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one |
| PubChem CID | 814514 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | Cc1ccc2[nH]c3c(=O)n(N)c(C)nc3c2c1 |
| InChI | InChI=1S/C12H12N4O/c1-6-3-4-9-8(5-6)10-11(15-9)12(17)16(13)7(2)14-10/h3-5,15H,13H2,1-2H3 |
| InChIKey | OQLOMJQTXYSSFH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one?
The IUPAC name of 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one (CID 814514) is 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one.
What is the SMILES notation for 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one?
The canonical SMILES for 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one is Cc1ccc2[nH]c3c(=O)n(N)c(C)nc3c2c1.
What is the InChIKey of 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one?
The InChIKey is OQLOMJQTXYSSFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O/c1-6-3-4-9-8(5-6)10-11(15-9)12(17)16(13)7(2)14-10/h3-5,15H,13H2,1-2H3.
What are the key properties of 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one?
3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one has a molecular weight of 228.25 g/mol, XLogP of 1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,8-dimethyl-5H-pyrimido[5,4-b]indol-4-one is sourced from PubChem (CID 814514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).