C17H31N3O — CID 81451690
1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methanone (PubChem CID 81451690) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 81451690 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methanone |
| SMILES | CC1CN(C(=O)C2CCC3CCCCC3N2)CC1N(C)C |
| InChI | InChI=1S/C17H31N3O/c1-12-10-20(11-16(12)19(2)3)17(21)15-9-8-13-6-4-5-7-14(13)18-15/h12-16,18H,4-11H2,1-3H3 |
| InChIKey | FQFQAFHUQYQCBM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |