C13H15NO4S — CID 81451697
3-hydroxy-4-[(2-methylthiolane-2-carbonyl)amino]benzoic acid (PubChem CID 81451697) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 3-hydroxy-4-[(2-methylthiolane-2-carbonyl)amino]benzoic acid.
| Compound Name | 3-hydroxy-4-[(2-methylthiolane-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 81451697 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3-hydroxy-4-[(2-methylthiolane-2-carbonyl)amino]benzoic acid |
| SMILES | CC1(C(=O)Nc2ccc(C(=O)O)cc2O)CCCS1 |
| InChI | InChI=1S/C13H15NO4S/c1-13(5-2-6-19-13)12(18)14-9-4-3-8(11(16)17)7-10(9)15/h3-4,7,15H,2,5-6H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | NQGACLMVJUWDDO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|