About 1,5-dihydropyrimido[5,4-b]indole-4-thione
1,5-dihydropyrimido[5,4-b]indole-4-thione (PubChem CID 814519) has the molecular formula C10H7N3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 1,5-dihydropyrimido[5,4-b]indole-4-thione.
Molecular Properties
| Compound Name | 1,5-dihydropyrimido[5,4-b]indole-4-thione |
| PubChem CID | 814519 |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 1,5-dihydropyrimido[5,4-b]indole-4-thione |
| SMILES | S=c1nc[nH]c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C10H7N3S/c14-10-9-8(11-5-12-10)6-3-1-2-4-7(6)13-9/h1-5,13H,(H,11,12,14) |
| InChIKey | YMNTVDMKBNZRJH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dihydropyrimido[5,4-b]indole-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydropyrimido[5,4-b]indole-4-thione?
The IUPAC name of 1,5-dihydropyrimido[5,4-b]indole-4-thione (CID 814519) is 1,5-dihydropyrimido[5,4-b]indole-4-thione.
What is the SMILES notation for 1,5-dihydropyrimido[5,4-b]indole-4-thione?
The canonical SMILES for 1,5-dihydropyrimido[5,4-b]indole-4-thione is S=c1nc[nH]c2c1[nH]c1ccccc12.
What is the InChIKey of 1,5-dihydropyrimido[5,4-b]indole-4-thione?
The InChIKey is YMNTVDMKBNZRJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3S/c14-10-9-8(11-5-12-10)6-3-1-2-4-7(6)13-9/h1-5,13H,(H,11,12,14).
What are the key properties of 1,5-dihydropyrimido[5,4-b]indole-4-thione?
1,5-dihydropyrimido[5,4-b]indole-4-thione has a molecular weight of 201.25 g/mol, XLogP of 2.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydropyrimido[5,4-b]indole-4-thione is sourced from PubChem (CID 814519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).