C12H19NO3S — CID 81452289
3-[cyclopropyl-(2-methylthiolane-2-carbonyl)amino]propanoic acid (PubChem CID 81452289) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 3-[cyclopropyl-(2-methylthiolane-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[cyclopropyl-(2-methylthiolane-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 81452289 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[cyclopropyl-(2-methylthiolane-2-carbonyl)amino]propanoic acid |
| SMILES | CC1(C(=O)N(CCC(=O)O)C2CC2)CCCS1 |
| InChI | InChI=1S/C12H19NO3S/c1-12(6-2-8-17-12)11(16)13(9-3-4-9)7-5-10(14)15/h9H,2-8H2,1H3,(H,14,15) |
| InChIKey | RINYNLNOPNIBRG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |