About [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone
[(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone (PubChem CID 81452504) has the molecular formula C15H18N2O2S
and a molecular weight of 290.39 g/mol. Its IUPAC name is [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone.
Molecular Properties
| Compound Name | [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone |
| PubChem CID | 81452504 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone |
| SMILES | CC1(C(=O)N2CC/C(=N/O)c3ccccc32)CCCS1 |
| InChI | InChI=1S/C15H18N2O2S/c1-15(8-4-10-20-15)14(18)17-9-7-12(16-19)11-5-2-3-6-13(11)17/h2-3,5-6,19H,4,7-10H2,1H3/b16-12- |
| InChIKey | IWKJLAXPOTYNDF-VBKFSLOCSA-N |
| XLogP | 2.89 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone?
The IUPAC name of [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone (CID 81452504) is [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone.
What is the SMILES notation for [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone?
The canonical SMILES for [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone is CC1(C(=O)N2CC/C(=N/O)c3ccccc32)CCCS1.
What is the InChIKey of [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone?
The InChIKey is IWKJLAXPOTYNDF-VBKFSLOCSA-N. The full InChI is InChI=1S/C15H18N2O2S/c1-15(8-4-10-20-15)14(18)17-9-7-12(16-19)11-5-2-3-6-13(11)17/h2-3,5-6,19H,4,7-10H2,1H3/b16-12-.
What are the key properties of [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone?
[(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone has a molecular weight of 290.39 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z)-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2-methylthiolan-2-yl)methanone is sourced from PubChem (CID 81452504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).